C26H26Br2N4O2 — CID 170444825
1-N,3-N-bis[(E)-(4-bromophenyl)methylideneamino]adamantane-1,3-dicarboxamide (PubChem CID 170444825) has the molecular formula C26H26Br2N4O2 and a molecular weight of 586.33 g/mol. Its IUPAC name is 1-N,3-N-bis[(E)-(4-bromophenyl)methylideneamino]adamantane-1,3-dicarboxamide.
| Compound Name | 1-N,3-N-bis[(E)-(4-bromophenyl)methylideneamino]adamantane-1,3-dicarboxamide |
|---|---|
| PubChem CID | 170444825 |
| Molecular Formula | C26H26Br2N4O2 |
| Molecular Weight | 586.33 g/mol |
| Exact Mass | 584.04 |
| IUPAC Name | 1-N,3-N-bis[(E)-(4-bromophenyl)methylideneamino]adamantane-1,3-dicarboxamide |
| SMILES | O=C(N/N=C/c1ccc(Br)cc1)C12CC3CC(C1)CC(C(=O)N/N=C/c1ccc(Br)cc1)(C3)C2 |
| InChI | InChI=1S/C26H26Br2N4O2/c27-21-5-1-17(2-6-21)14-29-31-23(33)25-10-19-9-20(11-25)13-26(12-19,16-25)24(34)32-30-15-18-3-7-22(28)8-4-18/h1-8,14-15,19-20H,9-13,16H2,(H,31,33)(H,32,34)/b29-14+,30-15+ |
| InChIKey | CSJOVBAQKQTMDP-VMTVTTGYSA-N |
| XLogP | 5.40 |
| TPSA | 82.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.33 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|