C25H28N2O2 — CID 135559036
N-[(E)-(4-hydroxyphenyl)methylideneamino]-3-(4-methylphenyl)adamantane-1-carboxamide (PubChem CID 135559036) has the molecular formula C25H28N2O2 and a molecular weight of 388.51 g/mol. Its IUPAC name is N-[(E)-(4-hydroxyphenyl)methylideneamino]-3-(4-methylphenyl)adamantane-1-carboxamide.
| Compound Name | N-[(E)-(4-hydroxyphenyl)methylideneamino]-3-(4-methylphenyl)adamantane-1-carboxamide |
|---|---|
| PubChem CID | 135559036 |
| Molecular Formula | C25H28N2O2 |
| Molecular Weight | 388.51 g/mol |
| Exact Mass | 388.22 |
| IUPAC Name | N-[(E)-(4-hydroxyphenyl)methylideneamino]-3-(4-methylphenyl)adamantane-1-carboxamide |
| SMILES | Cc1ccc(C23CC4CC(CC(C(=O)N/N=C/c5ccc(O)cc5)(C4)C2)C3)cc1 |
| InChI | InChI=1S/C25H28N2O2/c1-17-2-6-21(7-3-17)24-11-19-10-20(12-24)14-25(13-19,16-24)23(29)27-26-15-18-4-8-22(28)9-5-18/h2-9,15,19-20,28H,10-14,16H2,1H3,(H,27,29)/b26-15+ |
| InChIKey | VGOBYVFSNBZYPT-CVKSISIWSA-N |
| XLogP | 4.69 |
| TPSA | 61.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.51 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|