C20H26N2O2 — CID 171134360
N-[(4-hydroxyphenyl)methylideneamino]-3,5-dimethyladamantane-1-carboxamide (PubChem CID 171134360) has the molecular formula C20H26N2O2 and a molecular weight of 326.44 g/mol. Its IUPAC name is N-[(4-hydroxyphenyl)methylideneamino]-3,5-dimethyladamantane-1-carboxamide.
| Compound Name | N-[(4-hydroxyphenyl)methylideneamino]-3,5-dimethyladamantane-1-carboxamide |
|---|---|
| PubChem CID | 171134360 |
| Molecular Formula | C20H26N2O2 |
| Molecular Weight | 326.44 g/mol |
| Exact Mass | 326.20 |
| IUPAC Name | N-[(4-hydroxyphenyl)methylideneamino]-3,5-dimethyladamantane-1-carboxamide |
| SMILES | CC12CC3CC(C)(C1)CC(C(=O)NN=Cc1ccc(O)cc1)(C3)C2 |
| InChI | InChI=1S/C20H26N2O2/c1-18-7-15-8-19(2,11-18)13-20(9-15,12-18)17(24)22-21-10-14-3-5-16(23)6-4-14/h3-6,10,15,23H,7-9,11-13H2,1-2H3,(H,22,24) |
| InChIKey | PXKGIJJRCSPCDM-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 61.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.44 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|