C20H24ClFN2O — CID 110510580
N-[(E)-(2-chloro-6-fluorophenyl)methylideneamino]-3,5-dimethyladamantane-1-carboxamide (PubChem CID 110510580) has the molecular formula C20H24ClFN2O and a molecular weight of 362.88 g/mol. Its IUPAC name is N-[(E)-(2-chloro-6-fluorophenyl)methylideneamino]-3,5-dimethyladamantane-1-carboxamide.
| Compound Name | N-[(E)-(2-chloro-6-fluorophenyl)methylideneamino]-3,5-dimethyladamantane-1-carboxamide |
|---|---|
| PubChem CID | 110510580 |
| Molecular Formula | C20H24ClFN2O |
| Molecular Weight | 362.88 g/mol |
| Exact Mass | 362.16 |
| IUPAC Name | N-[(E)-(2-chloro-6-fluorophenyl)methylideneamino]-3,5-dimethyladamantane-1-carboxamide |
| SMILES | CC12CC3CC(C)(C1)CC(C(=O)N/N=C/c1c(F)cccc1Cl)(C3)C2 |
| InChI | InChI=1S/C20H24ClFN2O/c1-18-6-13-7-19(2,10-18)12-20(8-13,11-18)17(25)24-23-9-14-15(21)4-3-5-16(14)22/h3-5,9,13H,6-8,10-12H2,1-2H3,(H,24,25)/b23-9+ |
| InChIKey | QNRFCZLOERNDQN-NUGSKGIGSA-N |
| XLogP | 4.93 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.88 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|