C23H32N2O2 — CID 110510634
3,5-dimethyl-N-[(E)-(2-propoxyphenyl)methylideneamino]adamantane-1-carboxamide (PubChem CID 110510634) has the molecular formula C23H32N2O2 and a molecular weight of 368.52 g/mol. Its IUPAC name is 3,5-dimethyl-N-[(E)-(2-propoxyphenyl)methylideneamino]adamantane-1-carboxamide.
| Compound Name | 3,5-dimethyl-N-[(E)-(2-propoxyphenyl)methylideneamino]adamantane-1-carboxamide |
|---|---|
| PubChem CID | 110510634 |
| Molecular Formula | C23H32N2O2 |
| Molecular Weight | 368.52 g/mol |
| Exact Mass | 368.25 |
| IUPAC Name | 3,5-dimethyl-N-[(E)-(2-propoxyphenyl)methylideneamino]adamantane-1-carboxamide |
| SMILES | CCCOc1ccccc1/C=N/NC(=O)C12CC3CC(C)(CC(C)(C3)C1)C2 |
| InChI | InChI=1S/C23H32N2O2/c1-4-9-27-19-8-6-5-7-18(19)13-24-25-20(26)23-12-17-10-21(2,15-23)14-22(3,11-17)16-23/h5-8,13,17H,4,9-12,14-16H2,1-3H3,(H,25,26)/b24-13+ |
| InChIKey | OAZGVMHGJVOVNA-ZMOGYAJESA-N |
| XLogP | 4.92 |
| TPSA | 50.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.52 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|