C24H28N2O2 — CID 135708248
(3R,5S)-N-[(E)-(2-hydroxynaphthalen-1-yl)methylideneamino]-3,5-dimethyladamantane-1-carboxamide (PubChem CID 135708248) has the molecular formula C24H28N2O2 and a molecular weight of 376.50 g/mol. Its IUPAC name is (3R,5S)-N-[(E)-(2-hydroxynaphthalen-1-yl)methylideneamino]-3,5-dimethyladamantane-1-carboxamide.
| Compound Name | (3R,5S)-N-[(E)-(2-hydroxynaphthalen-1-yl)methylideneamino]-3,5-dimethyladamantane-1-carboxamide |
|---|---|
| PubChem CID | 135708248 |
| Molecular Formula | C24H28N2O2 |
| Molecular Weight | 376.50 g/mol |
| Exact Mass | 376.22 |
| IUPAC Name | (3R,5S)-N-[(E)-(2-hydroxynaphthalen-1-yl)methylideneamino]-3,5-dimethyladamantane-1-carboxamide |
| SMILES | C[C@]12CC3CC(C(=O)N/N=C/c4c(O)ccc5ccccc45)(C1)C[C@@](C)(C3)C2 |
| InChI | InChI=1S/C24H28N2O2/c1-22-9-16-10-23(2,13-22)15-24(11-16,14-22)21(28)26-25-12-19-18-6-4-3-5-17(18)7-8-20(19)27/h3-8,12,16,27H,9-11,13-15H2,1-2H3,(H,26,28)/b25-12+/t16?,22-,23+,24? |
| InChIKey | MUHJONKPYCZVEC-JMOQVJHCSA-N |
| XLogP | 4.99 |
| TPSA | 61.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.50 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|