C20H25N3O3 — CID 45022544
3,5-dimethyl-N-[(E)-(2-nitrophenyl)methylideneamino]adamantane-1-carboxamide (PubChem CID 45022544) has the molecular formula C20H25N3O3 and a molecular weight of 355.44 g/mol. Its IUPAC name is 3,5-dimethyl-N-[(E)-(2-nitrophenyl)methylideneamino]adamantane-1-carboxamide.
| Compound Name | 3,5-dimethyl-N-[(E)-(2-nitrophenyl)methylideneamino]adamantane-1-carboxamide |
|---|---|
| PubChem CID | 45022544 |
| Molecular Formula | C20H25N3O3 |
| Molecular Weight | 355.44 g/mol |
| Exact Mass | 355.19 |
| IUPAC Name | 3,5-dimethyl-N-[(E)-(2-nitrophenyl)methylideneamino]adamantane-1-carboxamide |
| SMILES | CC12CC3CC(C)(C1)CC(C(=O)N/N=C/c1ccccc1[N+](=O)[O-])(C3)C2 |
| InChI | InChI=1S/C20H25N3O3/c1-18-7-14-8-19(2,11-18)13-20(9-14,12-18)17(24)22-21-10-15-5-3-4-6-16(15)23(25)26/h3-6,10,14H,7-9,11-13H2,1-2H3,(H,22,24)/b21-10+ |
| InChIKey | COMRZXFLZRQCMV-UFFVCSGVSA-N |
| XLogP | 4.04 |
| TPSA | 84.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.44 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|