C13H15N3O3S2 — CID 6219950
2-(2-methyl-1,3-dithiolan-2-yl)-N-[(Z)-(2-nitrophenyl)methylideneamino]acetamide (PubChem CID 6219950) has the molecular formula C13H15N3O3S2 and a molecular weight of 325.41 g/mol. Its IUPAC name is 2-(2-methyl-1,3-dithiolan-2-yl)-N-[(Z)-(2-nitrophenyl)methylideneamino]acetamide.
| Compound Name | 2-(2-methyl-1,3-dithiolan-2-yl)-N-[(Z)-(2-nitrophenyl)methylideneamino]acetamide |
|---|---|
| PubChem CID | 6219950 |
| Molecular Formula | C13H15N3O3S2 |
| Molecular Weight | 325.41 g/mol |
| Exact Mass | 325.06 |
| IUPAC Name | 2-(2-methyl-1,3-dithiolan-2-yl)-N-[(Z)-(2-nitrophenyl)methylideneamino]acetamide |
| SMILES | CC1(CC(=O)N/N=C\c2ccccc2[N+](=O)[O-])SCCS1 |
| InChI | InChI=1S/C13H15N3O3S2/c1-13(20-6-7-21-13)8-12(17)15-14-9-10-4-2-3-5-11(10)16(18)19/h2-5,9H,6-8H2,1H3,(H,15,17)/b14-9- |
| InChIKey | LDCKXEQMTUORMN-ZROIWOOFSA-N |
| XLogP | 2.63 |
| TPSA | 84.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.41 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|