C18H19N3O4S2 — CID 126256300
2-(2-methyl-1,3-dithiolan-2-yl)-N-[(Z)-[5-(4-methyl-2-nitrophenyl)furan-2-yl]methylideneamino]acetamide (PubChem CID 126256300) has the molecular formula C18H19N3O4S2 and a molecular weight of 405.50 g/mol. Its IUPAC name is 2-(2-methyl-1,3-dithiolan-2-yl)-N-[(Z)-[5-(4-methyl-2-nitrophenyl)furan-2-yl]methylideneamino]acetamide.
| Compound Name | 2-(2-methyl-1,3-dithiolan-2-yl)-N-[(Z)-[5-(4-methyl-2-nitrophenyl)furan-2-yl]methylideneamino]acetamide |
|---|---|
| PubChem CID | 126256300 |
| Molecular Formula | C18H19N3O4S2 |
| Molecular Weight | 405.50 g/mol |
| Exact Mass | 405.08 |
| IUPAC Name | 2-(2-methyl-1,3-dithiolan-2-yl)-N-[(Z)-[5-(4-methyl-2-nitrophenyl)furan-2-yl]methylideneamino]acetamide |
| SMILES | Cc1ccc(-c2ccc(/C=N\NC(=O)CC3(C)SCCS3)o2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C18H19N3O4S2/c1-12-3-5-14(15(9-12)21(23)24)16-6-4-13(25-16)11-19-20-17(22)10-18(2)26-7-8-27-18/h3-6,9,11H,7-8,10H2,1-2H3,(H,20,22)/b19-11- |
| InChIKey | LIULLYXSZGJHAA-ODLFYWEKSA-N |
| XLogP | 4.20 |
| TPSA | 97.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.50 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|