C24H18N4O6 — CID 50884135
(E)-1-[5-(4-methyl-2-nitrophenyl)furan-2-yl]-N-[(E)-[5-(4-methyl-2-nitrophenyl)furan-2-yl]methylideneamino]methanimine (PubChem CID 50884135) has the molecular formula C24H18N4O6 and a molecular weight of 458.43 g/mol. Its IUPAC name is (E)-1-[5-(4-methyl-2-nitrophenyl)furan-2-yl]-N-[(E)-[5-(4-methyl-2-nitrophenyl)furan-2-yl]methylideneamino]methanimine.
| Compound Name | (E)-1-[5-(4-methyl-2-nitrophenyl)furan-2-yl]-N-[(E)-[5-(4-methyl-2-nitrophenyl)furan-2-yl]methylideneamino]methanimine |
|---|---|
| PubChem CID | 50884135 |
| Molecular Formula | C24H18N4O6 |
| Molecular Weight | 458.43 g/mol |
| Exact Mass | 458.12 |
| IUPAC Name | (E)-1-[5-(4-methyl-2-nitrophenyl)furan-2-yl]-N-[(E)-[5-(4-methyl-2-nitrophenyl)furan-2-yl]methylideneamino]methanimine |
| SMILES | Cc1ccc(-c2ccc(/C=N/N=C/c3ccc(-c4ccc(C)cc4[N+](=O)[O-])o3)o2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C24H18N4O6/c1-15-3-7-19(21(11-15)27(29)30)23-9-5-17(33-23)13-25-26-14-18-6-10-24(34-18)20-8-4-16(2)12-22(20)28(31)32/h3-14H,1-2H3/b25-13+,26-14+ |
| InChIKey | HTCPFVKJJYTIEL-BKHCZYBLSA-N |
| XLogP | 6.09 |
| TPSA | 137.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.43 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|