C31H26N2O7 — CID 6199167
(2E,6E)-4-methyl-2,6-bis[[5-(4-methyl-2-nitrophenyl)furan-2-yl]methylidene]cyclohexan-1-one (PubChem CID 6199167) has the molecular formula C31H26N2O7 and a molecular weight of 538.56 g/mol. Its IUPAC name is (2E,6E)-4-methyl-2,6-bis[[5-(4-methyl-2-nitrophenyl)furan-2-yl]methylidene]cyclohexan-1-one.
| Compound Name | (2E,6E)-4-methyl-2,6-bis[[5-(4-methyl-2-nitrophenyl)furan-2-yl]methylidene]cyclohexan-1-one |
|---|---|
| PubChem CID | 6199167 |
| Molecular Formula | C31H26N2O7 |
| Molecular Weight | 538.56 g/mol |
| Exact Mass | 538.17 |
| IUPAC Name | (2E,6E)-4-methyl-2,6-bis[[5-(4-methyl-2-nitrophenyl)furan-2-yl]methylidene]cyclohexan-1-one |
| SMILES | Cc1ccc(-c2ccc(/C=C3\CC(C)C/C(=C\c4ccc(-c5ccc(C)cc5[N+](=O)[O-])o4)C3=O)o2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C31H26N2O7/c1-18-4-8-25(27(14-18)32(35)36)29-10-6-23(39-29)16-21-12-20(3)13-22(31(21)34)17-24-7-11-30(40-24)26-9-5-19(2)15-28(26)33(37)38/h4-11,14-17,20H,12-13H2,1-3H3/b21-16+,22-17+ |
| InChIKey | ZIWBQMQEAWKNHX-LPFJTETCSA-N |
| XLogP | 8.11 |
| TPSA | 129.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.56 |
| LogP ≤ 5 | 8.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_one_ene_A(57)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|