C20H24Br2N2O3 — CID 136856659
(3R,5R)-N-[(Z)-(3,5-dibromo-2,4-dihydroxyphenyl)methylideneamino]-3,5-dimethyladamantane-1-carboxamide (PubChem CID 136856659) has the molecular formula C20H24Br2N2O3 and a molecular weight of 500.23 g/mol. Its IUPAC name is (3R,5R)-N-[(Z)-(3,5-dibromo-2,4-dihydroxyphenyl)methylideneamino]-3,5-dimethyladamantane-1-carboxamide.
| Compound Name | (3R,5R)-N-[(Z)-(3,5-dibromo-2,4-dihydroxyphenyl)methylideneamino]-3,5-dimethyladamantane-1-carboxamide |
|---|---|
| PubChem CID | 136856659 |
| Molecular Formula | C20H24Br2N2O3 |
| Molecular Weight | 500.23 g/mol |
| Exact Mass | 498.02 |
| IUPAC Name | (3R,5R)-N-[(Z)-(3,5-dibromo-2,4-dihydroxyphenyl)methylideneamino]-3,5-dimethyladamantane-1-carboxamide |
| SMILES | C[C@]12CC3CC(C(=O)N/N=C\c4cc(Br)c(O)c(Br)c4O)(C1)C[C@](C)(C3)C2 |
| InChI | InChI=1S/C20H24Br2N2O3/c1-18-4-11-5-19(2,8-18)10-20(6-11,9-18)17(27)24-23-7-12-3-13(21)16(26)14(22)15(12)25/h3,7,11,25-26H,4-6,8-10H2,1-2H3,(H,24,27)/b23-7-/t11?,18-,19-,20?/m1/s1 |
| InChIKey | FNQGYRPFUFAGIT-JDQAAHQQSA-N |
| XLogP | 5.07 |
| TPSA | 81.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.23 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|