C21H27BrN2O3 — CID 136787223
N-[(E)-(5-bromo-2-hydroxy-3-methoxyphenyl)methylideneamino]-3,5-dimethyladamantane-1-carboxamide (PubChem CID 136787223) has the molecular formula C21H27BrN2O3 and a molecular weight of 435.36 g/mol. Its IUPAC name is N-[(E)-(5-bromo-2-hydroxy-3-methoxyphenyl)methylideneamino]-3,5-dimethyladamantane-1-carboxamide.
| Compound Name | N-[(E)-(5-bromo-2-hydroxy-3-methoxyphenyl)methylideneamino]-3,5-dimethyladamantane-1-carboxamide |
|---|---|
| PubChem CID | 136787223 |
| Molecular Formula | C21H27BrN2O3 |
| Molecular Weight | 435.36 g/mol |
| Exact Mass | 434.12 |
| IUPAC Name | N-[(E)-(5-bromo-2-hydroxy-3-methoxyphenyl)methylideneamino]-3,5-dimethyladamantane-1-carboxamide |
| SMILES | COc1cc(Br)cc(/C=N/NC(=O)C23CC4CC(C)(CC(C)(C4)C2)C3)c1O |
| InChI | InChI=1S/C21H27BrN2O3/c1-19-6-13-7-20(2,10-19)12-21(8-13,11-19)18(26)24-23-9-14-4-15(22)5-16(27-3)17(14)25/h4-5,9,13,25H,6-8,10-12H2,1-3H3,(H,24,26)/b23-9+ |
| InChIKey | AXKCZMQEVHTZGQ-NUGSKGIGSA-N |
| XLogP | 4.61 |
| TPSA | 70.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.36 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|