C22H30N2O — CID 110510593
N-[(E)-(4-ethylphenyl)methylideneamino]-3,5-dimethyladamantane-1-carboxamide (PubChem CID 110510593) has the molecular formula C22H30N2O and a molecular weight of 338.50 g/mol. Its IUPAC name is N-[(E)-(4-ethylphenyl)methylideneamino]-3,5-dimethyladamantane-1-carboxamide.
| Compound Name | N-[(E)-(4-ethylphenyl)methylideneamino]-3,5-dimethyladamantane-1-carboxamide |
|---|---|
| PubChem CID | 110510593 |
| Molecular Formula | C22H30N2O |
| Molecular Weight | 338.50 g/mol |
| Exact Mass | 338.24 |
| IUPAC Name | N-[(E)-(4-ethylphenyl)methylideneamino]-3,5-dimethyladamantane-1-carboxamide |
| SMILES | CCc1ccc(/C=N/NC(=O)C23CC4CC(C)(CC(C)(C4)C2)C3)cc1 |
| InChI | InChI=1S/C22H30N2O/c1-4-16-5-7-17(8-6-16)12-23-24-19(25)22-11-18-9-20(2,14-22)13-21(3,10-18)15-22/h5-8,12,18H,4,9-11,13-15H2,1-3H3,(H,24,25)/b23-12+ |
| InChIKey | MEAUMHWIKVBOGY-FSJBWODESA-N |
| XLogP | 4.70 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.50 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|