C25H36N2O2 — CID 46494984
3,5-dimethyl-N-[(E)-[4-(3-methylbutoxy)phenyl]methylideneamino]adamantane-1-carboxamide (PubChem CID 46494984) has the molecular formula C25H36N2O2 and a molecular weight of 396.58 g/mol. Its IUPAC name is 3,5-dimethyl-N-[(E)-[4-(3-methylbutoxy)phenyl]methylideneamino]adamantane-1-carboxamide.
| Compound Name | 3,5-dimethyl-N-[(E)-[4-(3-methylbutoxy)phenyl]methylideneamino]adamantane-1-carboxamide |
|---|---|
| PubChem CID | 46494984 |
| Molecular Formula | C25H36N2O2 |
| Molecular Weight | 396.58 g/mol |
| Exact Mass | 396.28 |
| IUPAC Name | 3,5-dimethyl-N-[(E)-[4-(3-methylbutoxy)phenyl]methylideneamino]adamantane-1-carboxamide |
| SMILES | CC(C)CCOc1ccc(/C=N/NC(=O)C23CC4CC(C)(CC(C)(C4)C2)C3)cc1 |
| InChI | InChI=1S/C25H36N2O2/c1-18(2)9-10-29-21-7-5-19(6-8-21)14-26-27-22(28)25-13-20-11-23(3,16-25)15-24(4,12-20)17-25/h5-8,14,18,20H,9-13,15-17H2,1-4H3,(H,27,28)/b26-14+ |
| InChIKey | PLCAEHTVDPIQCS-VULFUBBASA-N |
| XLogP | 5.56 |
| TPSA | 50.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.58 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|