C14H16Cl2N2O — CID 40618936
(1S)-2,2-dichloro-N-[(Z)-(4-ethylphenyl)methylideneamino]-1-methylcyclopropane-1-carboxamide (PubChem CID 40618936) has the molecular formula C14H16Cl2N2O and a molecular weight of 299.20 g/mol. Its IUPAC name is (1S)-2,2-dichloro-N-[(Z)-(4-ethylphenyl)methylideneamino]-1-methylcyclopropane-1-carboxamide.
| Compound Name | (1S)-2,2-dichloro-N-[(Z)-(4-ethylphenyl)methylideneamino]-1-methylcyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 40618936 |
| Molecular Formula | C14H16Cl2N2O |
| Molecular Weight | 299.20 g/mol |
| Exact Mass | 298.06 |
| IUPAC Name | (1S)-2,2-dichloro-N-[(Z)-(4-ethylphenyl)methylideneamino]-1-methylcyclopropane-1-carboxamide |
| SMILES | CCc1ccc(/C=N\NC(=O)[C@]2(C)CC2(Cl)Cl)cc1 |
| InChI | InChI=1S/C14H16Cl2N2O/c1-3-10-4-6-11(7-5-10)8-17-18-12(19)13(2)9-14(13,15)16/h4-8H,3,9H2,1-2H3,(H,18,19)/b17-8-/t13-/m0/s1 |
| InChIKey | XYWXYOXSGCCDLB-KCXFFNSDSA-N |
| XLogP | 3.28 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.20 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|