C12H12Cl2N2O — CID 3131886
N-(benzylideneamino)-2,2-dichloro-1-methylcyclopropane-1-carboxamide (PubChem CID 3131886) has the molecular formula C12H12Cl2N2O and a molecular weight of 271.15 g/mol. Its IUPAC name is N-(benzylideneamino)-2,2-dichloro-1-methylcyclopropane-1-carboxamide.
| Compound Name | N-(benzylideneamino)-2,2-dichloro-1-methylcyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 3131886 |
| Molecular Formula | C12H12Cl2N2O |
| Molecular Weight | 271.15 g/mol |
| Exact Mass | 270.03 |
| IUPAC Name | N-(benzylideneamino)-2,2-dichloro-1-methylcyclopropane-1-carboxamide |
| SMILES | CC1(C(=O)NN=Cc2ccccc2)CC1(Cl)Cl |
| InChI | InChI=1S/C12H12Cl2N2O/c1-11(8-12(11,13)14)10(17)16-15-7-9-5-3-2-4-6-9/h2-7H,8H2,1H3,(H,16,17) |
| InChIKey | IPSDXOMLCSYKAU-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.15 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|