C23H26N2O2 — CID 135851423
(3S,6S)-N-[(E)-(2-hydroxynaphthalen-1-yl)methylideneamino]tricyclo[4.3.1.13,8]undecane-1-carboxamide (PubChem CID 135851423) has the molecular formula C23H26N2O2 and a molecular weight of 362.47 g/mol. Its IUPAC name is (3S,6S)-N-[(E)-(2-hydroxynaphthalen-1-yl)methylideneamino]tricyclo[4.3.1.13,8]undecane-1-carboxamide.
| Compound Name | (3S,6S)-N-[(E)-(2-hydroxynaphthalen-1-yl)methylideneamino]tricyclo[4.3.1.13,8]undecane-1-carboxamide |
|---|---|
| PubChem CID | 135851423 |
| Molecular Formula | C23H26N2O2 |
| Molecular Weight | 362.47 g/mol |
| Exact Mass | 362.20 |
| IUPAC Name | (3S,6S)-N-[(E)-(2-hydroxynaphthalen-1-yl)methylideneamino]tricyclo[4.3.1.13,8]undecane-1-carboxamide |
| SMILES | O=C(N/N=C/c1c(O)ccc2ccccc12)C12CC3C[C@H](CC[C@@H](C3)C1)C2 |
| InChI | InChI=1S/C23H26N2O2/c26-21-8-7-18-3-1-2-4-19(18)20(21)14-24-25-22(27)23-11-15-5-6-16(12-23)10-17(9-15)13-23/h1-4,7-8,14-17,26H,5-6,9-13H2,(H,25,27)/b24-14+/t15-,16-,17?,23?/m0/s1 |
| InChIKey | BEMNLKXTXOELGW-WSJVDZFBSA-N |
| XLogP | 4.60 |
| TPSA | 61.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.47 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|