C21H27NO — CID 98185677
(5R,7R)-3-(4-methylphenyl)-N-prop-2-enyladamantane-1-carboxamide (PubChem CID 98185677) has the molecular formula C21H27NO and a molecular weight of 309.45 g/mol. Its IUPAC name is (5R,7R)-3-(4-methylphenyl)-N-prop-2-enyladamantane-1-carboxamide.
| Compound Name | (5R,7R)-3-(4-methylphenyl)-N-prop-2-enyladamantane-1-carboxamide |
|---|---|
| PubChem CID | 98185677 |
| Molecular Formula | C21H27NO |
| Molecular Weight | 309.45 g/mol |
| Exact Mass | 309.21 |
| IUPAC Name | (5R,7R)-3-(4-methylphenyl)-N-prop-2-enyladamantane-1-carboxamide |
| SMILES | C=CCNC(=O)C12C[C@@H]3C[C@@H](C1)CC(c1ccc(C)cc1)(C3)C2 |
| InChI | InChI=1S/C21H27NO/c1-3-8-22-19(23)21-12-16-9-17(13-21)11-20(10-16,14-21)18-6-4-15(2)5-7-18/h3-7,16-17H,1,8-14H2,2H3,(H,22,23)/t16-,17-,20?,21?/m1/s1 |
| InChIKey | KXNOQNYULNXYCI-FBIZOPLVSA-N |
| XLogP | 4.14 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.45 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|