C21H30N2O — CID 119408280
N-(3-aminopropyl)-3-(4-methylphenyl)adamantane-1-carboxamide (PubChem CID 119408280) has the molecular formula C21H30N2O and a molecular weight of 326.48 g/mol. Its IUPAC name is N-(3-aminopropyl)-3-(4-methylphenyl)adamantane-1-carboxamide.
| Compound Name | N-(3-aminopropyl)-3-(4-methylphenyl)adamantane-1-carboxamide |
|---|---|
| PubChem CID | 119408280 |
| Molecular Formula | C21H30N2O |
| Molecular Weight | 326.48 g/mol |
| Exact Mass | 326.24 |
| IUPAC Name | N-(3-aminopropyl)-3-(4-methylphenyl)adamantane-1-carboxamide |
| SMILES | Cc1ccc(C23CC4CC(CC(C(=O)NCCCN)(C4)C2)C3)cc1 |
| InChI | InChI=1S/C21H30N2O/c1-15-3-5-18(6-4-15)20-10-16-9-17(11-20)13-21(12-16,14-20)19(24)23-8-2-7-22/h3-6,16-17H,2,7-14,22H2,1H3,(H,23,24) |
| InChIKey | MNZSLVPMEIDFRY-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.48 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|