C34H43NO7 — CID 91010967
4-[2-(3-carboxypropoxy)-4-[2-[[3-(4-methylphenyl)adamantane-1-carbonyl]amino]ethyl]phenoxy]butanoic acid (PubChem CID 91010967) has the molecular formula C34H43NO7 and a molecular weight of 577.72 g/mol. Its IUPAC name is 4-[2-(3-carboxypropoxy)-4-[2-[[3-(4-methylphenyl)adamantane-1-carbonyl]amino]ethyl]phenoxy]butanoic acid.
| Compound Name | 4-[2-(3-carboxypropoxy)-4-[2-[[3-(4-methylphenyl)adamantane-1-carbonyl]amino]ethyl]phenoxy]butanoic acid |
|---|---|
| PubChem CID | 91010967 |
| Molecular Formula | C34H43NO7 |
| Molecular Weight | 577.72 g/mol |
| Exact Mass | 577.30 |
| IUPAC Name | 4-[2-(3-carboxypropoxy)-4-[2-[[3-(4-methylphenyl)adamantane-1-carbonyl]amino]ethyl]phenoxy]butanoic acid |
| SMILES | Cc1ccc(C23CC4CC(CC(C(=O)NCCc5ccc(OCCCC(=O)O)c(OCCCC(=O)O)c5)(C4)C2)C3)cc1 |
| InChI | InChI=1S/C34H43NO7/c1-23-6-9-27(10-7-23)33-18-25-16-26(19-33)21-34(20-25,22-33)32(40)35-13-12-24-8-11-28(41-14-2-4-30(36)37)29(17-24)42-15-3-5-31(38)39/h6-11,17,25-26H,2-5,12-16,18-22H2,1H3,(H,35,40)(H,36,37)(H,38,39) |
| InChIKey | BHRGESNSVWORGL-UHFFFAOYSA-N |
| XLogP | 5.68 |
| TPSA | 122.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.72 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|