C26H31NO3 — CID 98367386
(5S,7S)-N-[(3,4-dimethoxyphenyl)methyl]-3-phenyladamantane-1-carboxamide (PubChem CID 98367386) has the molecular formula C26H31NO3 and a molecular weight of 405.54 g/mol. Its IUPAC name is (5S,7S)-N-[(3,4-dimethoxyphenyl)methyl]-3-phenyladamantane-1-carboxamide.
| Compound Name | (5S,7S)-N-[(3,4-dimethoxyphenyl)methyl]-3-phenyladamantane-1-carboxamide |
|---|---|
| PubChem CID | 98367386 |
| Molecular Formula | C26H31NO3 |
| Molecular Weight | 405.54 g/mol |
| Exact Mass | 405.23 |
| IUPAC Name | (5S,7S)-N-[(3,4-dimethoxyphenyl)methyl]-3-phenyladamantane-1-carboxamide |
| SMILES | COc1ccc(CNC(=O)C23C[C@H]4C[C@H](C2)CC(c2ccccc2)(C4)C3)cc1OC |
| InChI | InChI=1S/C26H31NO3/c1-29-22-9-8-18(11-23(22)30-2)16-27-24(28)26-14-19-10-20(15-26)13-25(12-19,17-26)21-6-4-3-5-7-21/h3-9,11,19-20H,10,12-17H2,1-2H3,(H,27,28)/t19-,20-,25?,26?/m0/s1 |
| InChIKey | RYDFHTRPVLICSI-XCGOXOSTSA-N |
| XLogP | 4.86 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.54 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |