C25H25ClF3NO2 — CID 15983341
3-(4-chlorophenyl)-N-[[3-(trifluoromethoxy)phenyl]methyl]adamantane-1-carboxamide (PubChem CID 15983341) has the molecular formula C25H25ClF3NO2 and a molecular weight of 463.93 g/mol. Its IUPAC name is 3-(4-chlorophenyl)-N-[[3-(trifluoromethoxy)phenyl]methyl]adamantane-1-carboxamide.
| Compound Name | 3-(4-chlorophenyl)-N-[[3-(trifluoromethoxy)phenyl]methyl]adamantane-1-carboxamide |
|---|---|
| PubChem CID | 15983341 |
| Molecular Formula | C25H25ClF3NO2 |
| Molecular Weight | 463.93 g/mol |
| Exact Mass | 463.15 |
| IUPAC Name | 3-(4-chlorophenyl)-N-[[3-(trifluoromethoxy)phenyl]methyl]adamantane-1-carboxamide |
| SMILES | O=C(NCc1cccc(OC(F)(F)F)c1)C12CC3CC(C1)CC(c1ccc(Cl)cc1)(C3)C2 |
| InChI | InChI=1S/C25H25ClF3NO2/c26-20-6-4-19(5-7-20)23-10-17-8-18(11-23)13-24(12-17,15-23)22(31)30-14-16-2-1-3-21(9-16)32-25(27,28)29/h1-7,9,17-18H,8,10-15H2,(H,30,31) |
| InChIKey | QUQJBYKWVPKHLH-UHFFFAOYSA-N |
| XLogP | 6.39 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.93 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |