C29H39NO — CID 7312500
(5S,7R)-N-(1-adamantylmethyl)-3-(4-methylphenyl)adamantane-1-carboxamide (PubChem CID 7312500) has the molecular formula C29H39NO and a molecular weight of 417.64 g/mol. Its IUPAC name is (5S,7R)-N-(1-adamantylmethyl)-3-(4-methylphenyl)adamantane-1-carboxamide.
| Compound Name | (5S,7R)-N-(1-adamantylmethyl)-3-(4-methylphenyl)adamantane-1-carboxamide |
|---|---|
| PubChem CID | 7312500 |
| Molecular Formula | C29H39NO |
| Molecular Weight | 417.64 g/mol |
| Exact Mass | 417.30 |
| IUPAC Name | (5S,7R)-N-(1-adamantylmethyl)-3-(4-methylphenyl)adamantane-1-carboxamide |
| SMILES | Cc1ccc(C23C[C@@H]4C[C@@H](CC(C(=O)NCC56CC7CC(CC(C7)C5)C6)(C4)C2)C3)cc1 |
| InChI | InChI=1S/C29H39NO/c1-19-2-4-25(5-3-19)28-13-23-9-24(14-28)16-29(15-23,17-28)26(31)30-18-27-10-20-6-21(11-27)8-22(7-20)12-27/h2-5,20-24H,6-18H2,1H3,(H,30,31)/t20?,21?,22?,23-,24+,27?,28?,29? |
| InChIKey | JBOZESARKKAUMK-FEDQGFLZSA-N |
| XLogP | 6.17 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.64 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |