C20H27NO — CID 98145472
N-methyl-2-[(5S,7S)-3-(4-methylphenyl)-1-adamantyl]acetamide (PubChem CID 98145472) has the molecular formula C20H27NO and a molecular weight of 297.44 g/mol. Its IUPAC name is N-methyl-2-[(5S,7S)-3-(4-methylphenyl)-1-adamantyl]acetamide.
| Compound Name | N-methyl-2-[(5S,7S)-3-(4-methylphenyl)-1-adamantyl]acetamide |
|---|---|
| PubChem CID | 98145472 |
| Molecular Formula | C20H27NO |
| Molecular Weight | 297.44 g/mol |
| Exact Mass | 297.21 |
| IUPAC Name | N-methyl-2-[(5S,7S)-3-(4-methylphenyl)-1-adamantyl]acetamide |
| SMILES | CNC(=O)CC12C[C@@H]3C[C@@H](C1)CC(c1ccc(C)cc1)(C3)C2 |
| InChI | InChI=1S/C20H27NO/c1-14-3-5-17(6-4-14)20-10-15-7-16(11-20)9-19(8-15,13-20)12-18(22)21-2/h3-6,15-16H,7-13H2,1-2H3,(H,21,22)/t15-,16-,19?,20?/m0/s1 |
| InChIKey | NROLQNLNCXUXKL-MVYVIFSASA-N |
| XLogP | 3.97 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.44 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |