C20H24F2O2S — CID 88869779
[3-(4-methylphenyl)-1-adamantyl]methyl 2,2-difluoro-2-sulfanylacetate (PubChem CID 88869779) has the molecular formula C20H24F2O2S and a molecular weight of 366.47 g/mol. Its IUPAC name is [3-(4-methylphenyl)-1-adamantyl]methyl 2,2-difluoro-2-sulfanylacetate.
| Compound Name | [3-(4-methylphenyl)-1-adamantyl]methyl 2,2-difluoro-2-sulfanylacetate |
|---|---|
| PubChem CID | 88869779 |
| Molecular Formula | C20H24F2O2S |
| Molecular Weight | 366.47 g/mol |
| Exact Mass | 366.15 |
| IUPAC Name | [3-(4-methylphenyl)-1-adamantyl]methyl 2,2-difluoro-2-sulfanylacetate |
| SMILES | Cc1ccc(C23CC4CC(CC(COC(=O)C(F)(F)S)(C4)C2)C3)cc1 |
| InChI | InChI=1S/C20H24F2O2S/c1-13-2-4-16(5-3-13)19-9-14-6-15(10-19)8-18(7-14,11-19)12-24-17(23)20(21,22)25/h2-5,14-15,25H,6-12H2,1H3 |
| InChIKey | PZOFIMCDYRQTFW-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 26.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.47 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|