C27H29N3O — CID 136912524
(5S,7S)-N-[(Z)-1H-indol-3-ylmethylideneamino]-3-(4-methylphenyl)adamantane-1-carboxamide (PubChem CID 136912524) has the molecular formula C27H29N3O and a molecular weight of 411.55 g/mol. Its IUPAC name is (5S,7S)-N-[(Z)-1H-indol-3-ylmethylideneamino]-3-(4-methylphenyl)adamantane-1-carboxamide.
| Compound Name | (5S,7S)-N-[(Z)-1H-indol-3-ylmethylideneamino]-3-(4-methylphenyl)adamantane-1-carboxamide |
|---|---|
| PubChem CID | 136912524 |
| Molecular Formula | C27H29N3O |
| Molecular Weight | 411.55 g/mol |
| Exact Mass | 411.23 |
| IUPAC Name | (5S,7S)-N-[(Z)-1H-indol-3-ylmethylideneamino]-3-(4-methylphenyl)adamantane-1-carboxamide |
| SMILES | Cc1ccc(C23C[C@@H]4C[C@H](CC(C(=O)N/N=C\c5c[nH]c6ccccc56)(C4)C2)C3)cc1 |
| InChI | InChI=1S/C27H29N3O/c1-18-6-8-22(9-7-18)26-11-19-10-20(12-26)14-27(13-19,17-26)25(31)30-29-16-21-15-28-24-5-3-2-4-23(21)24/h2-9,15-16,19-20,28H,10-14,17H2,1H3,(H,30,31)/b29-16-/t19-,20-,26?,27?/m0/s1 |
| InChIKey | ZWRALQDDTNOFIJ-VELRGUMISA-N |
| XLogP | 5.46 |
| TPSA | 57.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.55 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|