C21H27N3O4 — CID 177490719
(5R,7S)-3-cyclopentyl-N-[(E)-(5-nitrofuran-2-yl)methylideneamino]adamantane-1-carboxamide (PubChem CID 177490719) has the molecular formula C21H27N3O4 and a molecular weight of 385.46 g/mol. Its IUPAC name is (5R,7S)-3-cyclopentyl-N-[(E)-(5-nitrofuran-2-yl)methylideneamino]adamantane-1-carboxamide.
| Compound Name | (5R,7S)-3-cyclopentyl-N-[(E)-(5-nitrofuran-2-yl)methylideneamino]adamantane-1-carboxamide |
|---|---|
| PubChem CID | 177490719 |
| Molecular Formula | C21H27N3O4 |
| Molecular Weight | 385.46 g/mol |
| Exact Mass | 385.20 |
| IUPAC Name | (5R,7S)-3-cyclopentyl-N-[(E)-(5-nitrofuran-2-yl)methylideneamino]adamantane-1-carboxamide |
| SMILES | O=C(N/N=C/c1ccc([N+](=O)[O-])o1)C12C[C@H]3C[C@@H](C1)CC(C1CCCC1)(C3)C2 |
| InChI | InChI=1S/C21H27N3O4/c25-19(23-22-12-17-5-6-18(28-17)24(26)27)21-10-14-7-15(11-21)9-20(8-14,13-21)16-3-1-2-4-16/h5-6,12,14-16H,1-4,7-11,13H2,(H,23,25)/b22-12+/t14-,15+,20?,21? |
| InChIKey | SLCNIKDVSDPJMD-WGVGXIRESA-N |
| XLogP | 4.41 |
| TPSA | 97.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.46 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|