C18H23N3O2 — CID 3777262
1-(1-adamantyl)-3-[(4-hydroxyphenyl)methylideneamino]urea (PubChem CID 3777262) has the molecular formula C18H23N3O2 and a molecular weight of 313.40 g/mol. Its IUPAC name is 1-(1-adamantyl)-3-[(4-hydroxyphenyl)methylideneamino]urea.
| Compound Name | 1-(1-adamantyl)-3-[(4-hydroxyphenyl)methylideneamino]urea |
|---|---|
| PubChem CID | 3777262 |
| Molecular Formula | C18H23N3O2 |
| Molecular Weight | 313.40 g/mol |
| Exact Mass | 313.18 |
| IUPAC Name | 1-(1-adamantyl)-3-[(4-hydroxyphenyl)methylideneamino]urea |
| SMILES | O=C(NN=Cc1ccc(O)cc1)NC12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C18H23N3O2/c22-16-3-1-12(2-4-16)11-19-21-17(23)20-18-8-13-5-14(9-18)7-15(6-13)10-18/h1-4,11,13-15,22H,5-10H2,(H2,20,21,23) |
| InChIKey | DEJUNTRBMGIISC-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 73.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.40 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|