C19H22F3N3O — CID 4247069
1-(1-adamantyl)-3-[[2-(trifluoromethyl)phenyl]methylideneamino]urea (PubChem CID 4247069) has the molecular formula C19H22F3N3O and a molecular weight of 365.40 g/mol. Its IUPAC name is 1-(1-adamantyl)-3-[[2-(trifluoromethyl)phenyl]methylideneamino]urea.
| Compound Name | 1-(1-adamantyl)-3-[[2-(trifluoromethyl)phenyl]methylideneamino]urea |
|---|---|
| PubChem CID | 4247069 |
| Molecular Formula | C19H22F3N3O |
| Molecular Weight | 365.40 g/mol |
| Exact Mass | 365.17 |
| IUPAC Name | 1-(1-adamantyl)-3-[[2-(trifluoromethyl)phenyl]methylideneamino]urea |
| SMILES | O=C(NN=Cc1ccccc1C(F)(F)F)NC12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C19H22F3N3O/c20-19(21,22)16-4-2-1-3-15(16)11-23-25-17(26)24-18-8-12-5-13(9-18)7-14(6-12)10-18/h1-4,11-14H,5-10H2,(H2,24,25,26) |
| InChIKey | NEAJGIMKIWUJQC-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 53.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.40 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|