C18H20F3NO — CID 3118948
N-(1-adamantyl)-2-(trifluoromethyl)benzamide (PubChem CID 3118948) has the molecular formula C18H20F3NO and a molecular weight of 323.36 g/mol. Its IUPAC name is N-(1-adamantyl)-2-(trifluoromethyl)benzamide.
| Compound Name | N-(1-adamantyl)-2-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 3118948 |
| Molecular Formula | C18H20F3NO |
| Molecular Weight | 323.36 g/mol |
| Exact Mass | 323.15 |
| IUPAC Name | N-(1-adamantyl)-2-(trifluoromethyl)benzamide |
| SMILES | O=C(NC12CC3CC(CC(C3)C1)C2)c1ccccc1C(F)(F)F |
| InChI | InChI=1S/C18H20F3NO/c19-18(20,21)15-4-2-1-3-14(15)16(23)22-17-8-11-5-12(9-17)7-13(6-11)10-17/h1-4,11-13H,5-10H2,(H,22,23) |
| InChIKey | FXHPOENPCCODRV-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.36 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |