C32H30N2O2 — CID 170205515
N-[3-(naphthalene-1-carbonylamino)-1-adamantyl]naphthalene-1-carboxamide (PubChem CID 170205515) has the molecular formula C32H30N2O2 and a molecular weight of 474.60 g/mol. Its IUPAC name is N-[3-(naphthalene-1-carbonylamino)-1-adamantyl]naphthalene-1-carboxamide.
| Compound Name | N-[3-(naphthalene-1-carbonylamino)-1-adamantyl]naphthalene-1-carboxamide |
|---|---|
| PubChem CID | 170205515 |
| Molecular Formula | C32H30N2O2 |
| Molecular Weight | 474.60 g/mol |
| Exact Mass | 474.23 |
| IUPAC Name | N-[3-(naphthalene-1-carbonylamino)-1-adamantyl]naphthalene-1-carboxamide |
| SMILES | O=C(NC12CC3CC(C1)CC(NC(=O)c1cccc4ccccc14)(C3)C2)c1cccc2ccccc12 |
| InChI | InChI=1S/C32H30N2O2/c35-29(27-13-5-9-23-7-1-3-11-25(23)27)33-31-16-21-15-22(17-31)19-32(18-21,20-31)34-30(36)28-14-6-10-24-8-2-4-12-26(24)28/h1-14,21-22H,15-20H2,(H,33,35)(H,34,36) |
| InChIKey | GIPQSDBQTRQVIK-UHFFFAOYSA-N |
| XLogP | 6.24 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.60 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |