C25H28N4O2 — CID 142437899
1-[(E)-[4-[2-adamantylidene-(4-hydroxyphenyl)methyl]phenyl]methylideneamino]-3-aminourea (PubChem CID 142437899) has the molecular formula C25H28N4O2 and a molecular weight of 416.53 g/mol. Its IUPAC name is 1-[(E)-[4-[2-adamantylidene-(4-hydroxyphenyl)methyl]phenyl]methylideneamino]-3-aminourea.
| Compound Name | 1-[(E)-[4-[2-adamantylidene-(4-hydroxyphenyl)methyl]phenyl]methylideneamino]-3-aminourea |
|---|---|
| PubChem CID | 142437899 |
| Molecular Formula | C25H28N4O2 |
| Molecular Weight | 416.53 g/mol |
| Exact Mass | 416.22 |
| IUPAC Name | 1-[(E)-[4-[2-adamantylidene-(4-hydroxyphenyl)methyl]phenyl]methylideneamino]-3-aminourea |
| SMILES | NNC(=O)N/N=C/c1ccc(C(=C2C3CC4CC(C3)CC2C4)c2ccc(O)cc2)cc1 |
| InChI | InChI=1S/C25H28N4O2/c26-28-25(31)29-27-14-15-1-3-18(4-2-15)23(19-5-7-22(30)8-6-19)24-20-10-16-9-17(12-20)13-21(24)11-16/h1-8,14,16-17,20-21,30H,9-13,26H2,(H2,28,29,31)/b24-23-,27-14+ |
| InChIKey | KOEUDLKYHKZNKS-ONRRKFKZSA-N |
| XLogP | 4.16 |
| TPSA | 99.74 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.53 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|