C29H33NO3 — CID 142437940
(E)-3-[4-[2-adamantylidene-(4-hydroxyphenyl)methyl]phenyl]-N-hydroxy-N-propan-2-ylprop-2-enamide (PubChem CID 142437940) has the molecular formula C29H33NO3 and a molecular weight of 443.59 g/mol. Its IUPAC name is (E)-3-[4-[2-adamantylidene-(4-hydroxyphenyl)methyl]phenyl]-N-hydroxy-N-propan-2-ylprop-2-enamide.
| Compound Name | (E)-3-[4-[2-adamantylidene-(4-hydroxyphenyl)methyl]phenyl]-N-hydroxy-N-propan-2-ylprop-2-enamide |
|---|---|
| PubChem CID | 142437940 |
| Molecular Formula | C29H33NO3 |
| Molecular Weight | 443.59 g/mol |
| Exact Mass | 443.25 |
| IUPAC Name | (E)-3-[4-[2-adamantylidene-(4-hydroxyphenyl)methyl]phenyl]-N-hydroxy-N-propan-2-ylprop-2-enamide |
| SMILES | CC(C)N(O)C(=O)/C=C/c1ccc(C(=C2C3CC4CC(C3)CC2C4)c2ccc(O)cc2)cc1 |
| InChI | InChI=1S/C29H33NO3/c1-18(2)30(33)27(32)12-5-19-3-6-22(7-4-19)28(23-8-10-26(31)11-9-23)29-24-14-20-13-21(16-24)17-25(29)15-20/h3-12,18,20-21,24-25,31,33H,13-17H2,1-2H3/b12-5+,29-28- |
| InChIKey | HLHSXWTVPKEEEN-NRUNKIMCSA-N |
| XLogP | 6.29 |
| TPSA | 60.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.59 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|