C25H28O — CID 141110576
4-[9-bicyclo[3.3.1]nonanylidene-[4-[(E)-prop-1-enyl]phenyl]methyl]phenol (PubChem CID 141110576) has the molecular formula C25H28O and a molecular weight of 344.50 g/mol. Its IUPAC name is 4-[9-bicyclo[3.3.1]nonanylidene-[4-[(E)-prop-1-enyl]phenyl]methyl]phenol.
| Compound Name | 4-[9-bicyclo[3.3.1]nonanylidene-[4-[(E)-prop-1-enyl]phenyl]methyl]phenol |
|---|---|
| PubChem CID | 141110576 |
| Molecular Formula | C25H28O |
| Molecular Weight | 344.50 g/mol |
| Exact Mass | 344.21 |
| IUPAC Name | 4-[9-bicyclo[3.3.1]nonanylidene-[4-[(E)-prop-1-enyl]phenyl]methyl]phenol |
| SMILES | C/C=C/c1ccc(C(=C2C3CCCC2CCC3)c2ccc(O)cc2)cc1 |
| InChI | InChI=1S/C25H28O/c1-2-5-18-10-12-21(13-11-18)25(22-14-16-23(26)17-15-22)24-19-6-3-7-20(24)9-4-8-19/h2,5,10-17,19-20,26H,3-4,6-9H2,1H3/b5-2+,25-24? |
| InChIKey | DQXAALCJNLPXQD-PZJOZTOXSA-N |
| XLogP | 6.83 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.50 |
| LogP ≤ 5 | 6.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |