C26H30O4 — CID 46206807
4-[4-[9-bicyclo[3.3.1]nonanylidene-(4-hydroxyphenyl)methyl]phenoxy]butanoic acid (PubChem CID 46206807) has the molecular formula C26H30O4 and a molecular weight of 406.52 g/mol. Its IUPAC name is 4-[4-[9-bicyclo[3.3.1]nonanylidene-(4-hydroxyphenyl)methyl]phenoxy]butanoic acid.
| Compound Name | 4-[4-[9-bicyclo[3.3.1]nonanylidene-(4-hydroxyphenyl)methyl]phenoxy]butanoic acid |
|---|---|
| PubChem CID | 46206807 |
| Molecular Formula | C26H30O4 |
| Molecular Weight | 406.52 g/mol |
| Exact Mass | 406.21 |
| IUPAC Name | 4-[4-[9-bicyclo[3.3.1]nonanylidene-(4-hydroxyphenyl)methyl]phenoxy]butanoic acid |
| SMILES | O=C(O)CCCOc1ccc(C(=C2C3CCCC2CCC3)c2ccc(O)cc2)cc1 |
| InChI | InChI=1S/C26H30O4/c27-22-13-9-20(10-14-22)26(25-18-4-1-5-19(25)7-2-6-18)21-11-15-23(16-12-21)30-17-3-8-24(28)29/h9-16,18-19,27H,1-8,17H2,(H,28,29) |
| InChIKey | DGWXQNBGRPDJIE-UHFFFAOYSA-N |
| XLogP | 6.04 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.52 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|