C27H34O3 — CID 11992669
4-[4-[phenyl-(3,3,5,5-tetramethylcyclohexylidene)methyl]phenoxy]butanoic acid (PubChem CID 11992669) has the molecular formula C27H34O3 and a molecular weight of 406.57 g/mol. Its IUPAC name is 4-[4-[phenyl-(3,3,5,5-tetramethylcyclohexylidene)methyl]phenoxy]butanoic acid.
| Compound Name | 4-[4-[phenyl-(3,3,5,5-tetramethylcyclohexylidene)methyl]phenoxy]butanoic acid |
|---|---|
| PubChem CID | 11992669 |
| Molecular Formula | C27H34O3 |
| Molecular Weight | 406.57 g/mol |
| Exact Mass | 406.25 |
| IUPAC Name | 4-[4-[phenyl-(3,3,5,5-tetramethylcyclohexylidene)methyl]phenoxy]butanoic acid |
| SMILES | CC1(C)CC(=C(c2ccccc2)c2ccc(OCCCC(=O)O)cc2)CC(C)(C)C1 |
| InChI | InChI=1S/C27H34O3/c1-26(2)17-22(18-27(3,4)19-26)25(20-9-6-5-7-10-20)21-12-14-23(15-13-21)30-16-8-11-24(28)29/h5-7,9-10,12-15H,8,11,16-19H2,1-4H3,(H,28,29) |
| InChIKey | IUXLRIKNIMNSCZ-UHFFFAOYSA-N |
| XLogP | 6.97 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.57 |
| LogP ≤ 5 | 6.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|