C26H32O4 — CID 142996872
4-[4-[(E)-(4-hydroxyphenyl)-(3,3,5-trimethylcyclohexylidene)methyl]phenoxy]butanoic acid (PubChem CID 142996872) has the molecular formula C26H32O4 and a molecular weight of 408.54 g/mol. Its IUPAC name is 4-[4-[(E)-(4-hydroxyphenyl)-(3,3,5-trimethylcyclohexylidene)methyl]phenoxy]butanoic acid.
| Compound Name | 4-[4-[(E)-(4-hydroxyphenyl)-(3,3,5-trimethylcyclohexylidene)methyl]phenoxy]butanoic acid |
|---|---|
| PubChem CID | 142996872 |
| Molecular Formula | C26H32O4 |
| Molecular Weight | 408.54 g/mol |
| Exact Mass | 408.23 |
| IUPAC Name | 4-[4-[(E)-(4-hydroxyphenyl)-(3,3,5-trimethylcyclohexylidene)methyl]phenoxy]butanoic acid |
| SMILES | CC1C/C(=C(/c2ccc(O)cc2)c2ccc(OCCCC(=O)O)cc2)CC(C)(C)C1 |
| InChI | InChI=1S/C26H32O4/c1-18-15-21(17-26(2,3)16-18)25(19-6-10-22(27)11-7-19)20-8-12-23(13-9-20)30-14-4-5-24(28)29/h6-13,18,27H,4-5,14-17H2,1-3H3,(H,28,29)/b25-21+ |
| InChIKey | PHQKTAZFVXDPGF-NJNXFGOHSA-N |
| XLogP | 6.28 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.54 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|