C19H30N2O3 — CID 118310276
4-[3-amino-4-[[(1R,5R)-3,3,5-trimethylcyclohexyl]amino]phenoxy]butanoic acid (PubChem CID 118310276) has the molecular formula C19H30N2O3 and a molecular weight of 334.46 g/mol. Its IUPAC name is 4-[3-amino-4-[[(1R,5R)-3,3,5-trimethylcyclohexyl]amino]phenoxy]butanoic acid.
| Compound Name | 4-[3-amino-4-[[(1R,5R)-3,3,5-trimethylcyclohexyl]amino]phenoxy]butanoic acid |
|---|---|
| PubChem CID | 118310276 |
| Molecular Formula | C19H30N2O3 |
| Molecular Weight | 334.46 g/mol |
| Exact Mass | 334.23 |
| IUPAC Name | 4-[3-amino-4-[[(1R,5R)-3,3,5-trimethylcyclohexyl]amino]phenoxy]butanoic acid |
| SMILES | C[C@H]1C[C@@H](Nc2ccc(OCCCC(=O)O)cc2N)CC(C)(C)C1 |
| InChI | InChI=1S/C19H30N2O3/c1-13-9-14(12-19(2,3)11-13)21-17-7-6-15(10-16(17)20)24-8-4-5-18(22)23/h6-7,10,13-14,21H,4-5,8-9,11-12,20H2,1-3H3,(H,22,23)/t13-,14+/m0/s1 |
| InChIKey | YSRXLSCJZANJSX-UONOGXRCSA-N |
| XLogP | 4.14 |
| TPSA | 84.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.46 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|