C36H56N4O4 — CID 160757381
methyl 5-amino-2-methyl-4-[[(1S,5S)-3,3,5-trimethylcyclohexyl]amino]benzoate;methyl 5-amino-2-methyl-4-[[(1R,5R)-3,3,5-trimethylcyclohexyl]amino]benzoate (PubChem CID 160757381) has the molecular formula C36H56N4O4 and a molecular weight of 608.87 g/mol. Its IUPAC name is methyl 5-amino-2-methyl-4-[[(1S,5S)-3,3,5-trimethylcyclohexyl]amino]benzoate;methyl 5-amino-2-methyl-4-[[(1R,5R)-3,3,5-trimethylcyclohexyl]amino]benzoate.
| Compound Name | methyl 5-amino-2-methyl-4-[[(1S,5S)-3,3,5-trimethylcyclohexyl]amino]benzoate;methyl 5-amino-2-methyl-4-[[(1R,5R)-3,3,5-trimethylcyclohexyl]amino]benzoate |
|---|---|
| PubChem CID | 160757381 |
| Molecular Formula | C36H56N4O4 |
| Molecular Weight | 608.87 g/mol |
| Exact Mass | 608.43 |
| IUPAC Name | methyl 5-amino-2-methyl-4-[[(1S,5S)-3,3,5-trimethylcyclohexyl]amino]benzoate;methyl 5-amino-2-methyl-4-[[(1R,5R)-3,3,5-trimethylcyclohexyl]amino]benzoate |
| SMILES | COC(=O)c1cc(N)c(N[C@@H]2C[C@H](C)CC(C)(C)C2)cc1C.COC(=O)c1cc(N)c(N[C@H]2C[C@@H](C)CC(C)(C)C2)cc1C |
| InChI | InChI=1S/2C18H28N2O2/c2*1-11-6-13(10-18(3,4)9-11)20-16-7-12(2)14(8-15(16)19)17(21)22-5/h2*7-8,11,13,20H,6,9-10,19H2,1-5H3/t2*11-,13+/m10/s1 |
| InChIKey | RXPMUVOXALBIKH-YTURIVCJSA-N |
| XLogP | 7.98 |
| TPSA | 128.70 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.87 |
| LogP ≤ 5 | 7.98 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|