C17H26N2O3 — CID 118310326
2-[3-amino-4-[[(1S,5S)-3,3,5-trimethylcyclohexyl]amino]phenoxy]acetic acid (PubChem CID 118310326) has the molecular formula C17H26N2O3 and a molecular weight of 306.41 g/mol. Its IUPAC name is 2-[3-amino-4-[[(1S,5S)-3,3,5-trimethylcyclohexyl]amino]phenoxy]acetic acid.
| Compound Name | 2-[3-amino-4-[[(1S,5S)-3,3,5-trimethylcyclohexyl]amino]phenoxy]acetic acid |
|---|---|
| PubChem CID | 118310326 |
| Molecular Formula | C17H26N2O3 |
| Molecular Weight | 306.41 g/mol |
| Exact Mass | 306.19 |
| IUPAC Name | 2-[3-amino-4-[[(1S,5S)-3,3,5-trimethylcyclohexyl]amino]phenoxy]acetic acid |
| SMILES | C[C@@H]1C[C@H](Nc2ccc(OCC(=O)O)cc2N)CC(C)(C)C1 |
| InChI | InChI=1S/C17H26N2O3/c1-11-6-12(9-17(2,3)8-11)19-15-5-4-13(7-14(15)18)22-10-16(20)21/h4-5,7,11-12,19H,6,8-10,18H2,1-3H3,(H,20,21)/t11-,12+/m1/s1 |
| InChIKey | TZOUZQCUPILXDG-NEPJUHHUSA-N |
| XLogP | 3.36 |
| TPSA | 84.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.41 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|