C40H64N4O4 — CID 161282388
methyl 3-[5-amino-2-methyl-4-[[(1S,5S)-3,3,5-trimethylcyclohexyl]amino]phenyl]propanoate;methyl 3-[5-amino-2-methyl-4-[[(1R,5R)-3,3,5-trimethylcyclohexyl]amino]phenyl]propanoate (PubChem CID 161282388) has the molecular formula C40H64N4O4 and a molecular weight of 664.98 g/mol. Its IUPAC name is methyl 3-[5-amino-2-methyl-4-[[(1S,5S)-3,3,5-trimethylcyclohexyl]amino]phenyl]propanoate;methyl 3-[5-amino-2-methyl-4-[[(1R,5R)-3,3,5-trimethylcyclohexyl]amino]phenyl]propanoate.
| Compound Name | methyl 3-[5-amino-2-methyl-4-[[(1S,5S)-3,3,5-trimethylcyclohexyl]amino]phenyl]propanoate;methyl 3-[5-amino-2-methyl-4-[[(1R,5R)-3,3,5-trimethylcyclohexyl]amino]phenyl]propanoate |
|---|---|
| PubChem CID | 161282388 |
| Molecular Formula | C40H64N4O4 |
| Molecular Weight | 664.98 g/mol |
| Exact Mass | 664.49 |
| IUPAC Name | methyl 3-[5-amino-2-methyl-4-[[(1S,5S)-3,3,5-trimethylcyclohexyl]amino]phenyl]propanoate;methyl 3-[5-amino-2-methyl-4-[[(1R,5R)-3,3,5-trimethylcyclohexyl]amino]phenyl]propanoate |
| SMILES | COC(=O)CCc1cc(N)c(N[C@@H]2C[C@H](C)CC(C)(C)C2)cc1C.COC(=O)CCc1cc(N)c(N[C@H]2C[C@@H](C)CC(C)(C)C2)cc1C |
| InChI | InChI=1S/2C20H32N2O2/c2*1-13-8-16(12-20(3,4)11-13)22-18-9-14(2)15(10-17(18)21)6-7-19(23)24-5/h2*9-10,13,16,22H,6-8,11-12,21H2,1-5H3/t2*13-,16+/m10/s1 |
| InChIKey | VFGLXXZZKGMLIK-YWZNMANXSA-N |
| XLogP | 8.62 |
| TPSA | 128.70 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 664.98 |
| LogP ≤ 5 | 8.62 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|