C17H26N2O2 — CID 130363778
methyl 4-amino-3-[[(1R,5S)-3,3,5-trimethylcyclohexyl]amino]benzoate (PubChem CID 130363778) has the molecular formula C17H26N2O2 and a molecular weight of 290.41 g/mol. Its IUPAC name is methyl 4-amino-3-[[(1R,5S)-3,3,5-trimethylcyclohexyl]amino]benzoate.
| Compound Name | methyl 4-amino-3-[[(1R,5S)-3,3,5-trimethylcyclohexyl]amino]benzoate |
|---|---|
| PubChem CID | 130363778 |
| Molecular Formula | C17H26N2O2 |
| Molecular Weight | 290.41 g/mol |
| Exact Mass | 290.20 |
| IUPAC Name | methyl 4-amino-3-[[(1R,5S)-3,3,5-trimethylcyclohexyl]amino]benzoate |
| SMILES | COC(=O)c1ccc(N)c(N[C@@H]2C[C@@H](C)CC(C)(C)C2)c1 |
| InChI | InChI=1S/C17H26N2O2/c1-11-7-13(10-17(2,3)9-11)19-15-8-12(16(20)21-4)5-6-14(15)18/h5-6,8,11,13,19H,7,9-10,18H2,1-4H3/t11-,13-/m1/s1 |
| InChIKey | RBKOOAHDOLZZHE-DGCLKSJQSA-N |
| XLogP | 3.68 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.41 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|