C19H30N2O2 — CID 118318649
methyl 2-[5-amino-2-methyl-4-[[(1R,5R)-3,3,5-trimethylcyclohexyl]amino]phenyl]acetate (PubChem CID 118318649) has the molecular formula C19H30N2O2 and a molecular weight of 318.46 g/mol. Its IUPAC name is methyl 2-[5-amino-2-methyl-4-[[(1R,5R)-3,3,5-trimethylcyclohexyl]amino]phenyl]acetate.
| Compound Name | methyl 2-[5-amino-2-methyl-4-[[(1R,5R)-3,3,5-trimethylcyclohexyl]amino]phenyl]acetate |
|---|---|
| PubChem CID | 118318649 |
| Molecular Formula | C19H30N2O2 |
| Molecular Weight | 318.46 g/mol |
| Exact Mass | 318.23 |
| IUPAC Name | methyl 2-[5-amino-2-methyl-4-[[(1R,5R)-3,3,5-trimethylcyclohexyl]amino]phenyl]acetate |
| SMILES | COC(=O)Cc1cc(N)c(N[C@@H]2C[C@H](C)CC(C)(C)C2)cc1C |
| InChI | InChI=1S/C19H30N2O2/c1-12-6-15(11-19(3,4)10-12)21-17-7-13(2)14(8-16(17)20)9-18(22)23-5/h7-8,12,15,21H,6,9-11,20H2,1-5H3/t12-,15+/m0/s1 |
| InChIKey | OWRWIVZEOOWBPQ-SWLSCSKDSA-N |
| XLogP | 3.92 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.46 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|