C18H28N2O2 — CID 175168816
[5-amino-2-methyl-4-[(3,3,5-trimethylcyclohexyl)amino]phenyl] acetate (PubChem CID 175168816) has the molecular formula C18H28N2O2 and a molecular weight of 304.43 g/mol. Its IUPAC name is [5-amino-2-methyl-4-[(3,3,5-trimethylcyclohexyl)amino]phenyl] acetate.
| Compound Name | [5-amino-2-methyl-4-[(3,3,5-trimethylcyclohexyl)amino]phenyl] acetate |
|---|---|
| PubChem CID | 175168816 |
| Molecular Formula | C18H28N2O2 |
| Molecular Weight | 304.43 g/mol |
| Exact Mass | 304.22 |
| IUPAC Name | [5-amino-2-methyl-4-[(3,3,5-trimethylcyclohexyl)amino]phenyl] acetate |
| SMILES | CC(=O)Oc1cc(N)c(NC2CC(C)CC(C)(C)C2)cc1C |
| InChI | InChI=1S/C18H28N2O2/c1-11-6-14(10-18(4,5)9-11)20-16-7-12(2)17(8-15(16)19)22-13(3)21/h7-8,11,14,20H,6,9-10,19H2,1-5H3 |
| InChIKey | SAPDEVDFFOVZRT-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.43 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|