C17H24ClNO2 — CID 43672724
methyl 2-chloro-5-[(3,3,5-trimethylcyclohexyl)amino]benzoate (PubChem CID 43672724) has the molecular formula C17H24ClNO2 and a molecular weight of 309.84 g/mol. Its IUPAC name is methyl 2-chloro-5-[(3,3,5-trimethylcyclohexyl)amino]benzoate.
| Compound Name | methyl 2-chloro-5-[(3,3,5-trimethylcyclohexyl)amino]benzoate |
|---|---|
| PubChem CID | 43672724 |
| Molecular Formula | C17H24ClNO2 |
| Molecular Weight | 309.84 g/mol |
| Exact Mass | 309.15 |
| IUPAC Name | methyl 2-chloro-5-[(3,3,5-trimethylcyclohexyl)amino]benzoate |
| SMILES | COC(=O)c1cc(NC2CC(C)CC(C)(C)C2)ccc1Cl |
| InChI | InChI=1S/C17H24ClNO2/c1-11-7-13(10-17(2,3)9-11)19-12-5-6-15(18)14(8-12)16(20)21-4/h5-6,8,11,13,19H,7,9-10H2,1-4H3 |
| InChIKey | IJVSAENPOQYXNK-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.84 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |