C26H26O4 — CID 90901535
4-[4-[1-(4-hydroxyphenyl)-2-phenylbut-2-enyl]phenoxy]butanoic acid (PubChem CID 90901535) has the molecular formula C26H26O4 and a molecular weight of 402.49 g/mol. Its IUPAC name is 4-[4-[1-(4-hydroxyphenyl)-2-phenylbut-2-enyl]phenoxy]butanoic acid.
| Compound Name | 4-[4-[1-(4-hydroxyphenyl)-2-phenylbut-2-enyl]phenoxy]butanoic acid |
|---|---|
| PubChem CID | 90901535 |
| Molecular Formula | C26H26O4 |
| Molecular Weight | 402.49 g/mol |
| Exact Mass | 402.18 |
| IUPAC Name | 4-[4-[1-(4-hydroxyphenyl)-2-phenylbut-2-enyl]phenoxy]butanoic acid |
| SMILES | CC=C(c1ccccc1)C(c1ccc(O)cc1)c1ccc(OCCCC(=O)O)cc1 |
| InChI | InChI=1S/C26H26O4/c1-2-24(19-7-4-3-5-8-19)26(20-10-14-22(27)15-11-20)21-12-16-23(17-13-21)30-18-6-9-25(28)29/h2-5,7-8,10-17,26-27H,6,9,18H2,1H3,(H,28,29) |
| InChIKey | IECGHUSUBNJELQ-UHFFFAOYSA-N |
| XLogP | 5.87 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.49 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|