C22H20O — CID 70549911
4-[(Z)-1,2-diphenylbut-2-enyl]phenol (PubChem CID 70549911) has the molecular formula C22H20O and a molecular weight of 300.40 g/mol. Its IUPAC name is 4-[(Z)-1,2-diphenylbut-2-enyl]phenol.
| Compound Name | 4-[(Z)-1,2-diphenylbut-2-enyl]phenol |
|---|---|
| PubChem CID | 70549911 |
| Molecular Formula | C22H20O |
| Molecular Weight | 300.40 g/mol |
| Exact Mass | 300.15 |
| IUPAC Name | 4-[(Z)-1,2-diphenylbut-2-enyl]phenol |
| SMILES | C/C=C(\c1ccccc1)C(c1ccccc1)c1ccc(O)cc1 |
| InChI | InChI=1S/C22H20O/c1-2-21(17-9-5-3-6-10-17)22(18-11-7-4-8-12-18)19-13-15-20(23)16-14-19/h2-16,22-23H,1H3/b21-2+ |
| InChIKey | AACAWZWINYSZIP-WKOHNKLBSA-N |
| XLogP | 5.63 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.40 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |