C35H42O2Si — CID 102346407
[(E)-4-phenyl-1-tri(propan-2-yl)silylhex-4-en-1-yn-3-yl] 2,2-diphenylacetate (PubChem CID 102346407) has the molecular formula C35H42O2Si and a molecular weight of 522.81 g/mol. Its IUPAC name is [(E)-4-phenyl-1-tri(propan-2-yl)silylhex-4-en-1-yn-3-yl] 2,2-diphenylacetate.
| Compound Name | [(E)-4-phenyl-1-tri(propan-2-yl)silylhex-4-en-1-yn-3-yl] 2,2-diphenylacetate |
|---|---|
| PubChem CID | 102346407 |
| Molecular Formula | C35H42O2Si |
| Molecular Weight | 522.81 g/mol |
| Exact Mass | 522.30 |
| IUPAC Name | [(E)-4-phenyl-1-tri(propan-2-yl)silylhex-4-en-1-yn-3-yl] 2,2-diphenylacetate |
| SMILES | C/C=C(\c1ccccc1)C(C#C[Si](C(C)C)(C(C)C)C(C)C)OC(=O)C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C35H42O2Si/c1-8-32(29-18-12-9-13-19-29)33(24-25-38(26(2)3,27(4)5)28(6)7)37-35(36)34(30-20-14-10-15-21-30)31-22-16-11-17-23-31/h8-23,26-28,33-34H,1-7H3/b32-8+ |
| InChIKey | JLRYWUZIFSLJBP-LTYZHWICSA-N |
| XLogP | 9.06 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.81 |
| LogP ≤ 5 | 9.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|