C19H20O4 — CID 132941328
[(1R)-1-(1,3-dioxolan-2-yl)ethyl] 2,2-diphenylacetate (PubChem CID 132941328) has the molecular formula C19H20O4 and a molecular weight of 312.37 g/mol. Its IUPAC name is [(1R)-1-(1,3-dioxolan-2-yl)ethyl] 2,2-diphenylacetate.
| Compound Name | [(1R)-1-(1,3-dioxolan-2-yl)ethyl] 2,2-diphenylacetate |
|---|---|
| PubChem CID | 132941328 |
| Molecular Formula | C19H20O4 |
| Molecular Weight | 312.37 g/mol |
| Exact Mass | 312.14 |
| IUPAC Name | [(1R)-1-(1,3-dioxolan-2-yl)ethyl] 2,2-diphenylacetate |
| SMILES | C[C@@H](OC(=O)C(c1ccccc1)c1ccccc1)C1OCCO1 |
| InChI | InChI=1S/C19H20O4/c1-14(19-21-12-13-22-19)23-18(20)17(15-8-4-2-5-9-15)16-10-6-3-7-11-16/h2-11,14,17,19H,12-13H2,1H3/t14-/m1/s1 |
| InChIKey | GHCVYWPMXNLUPC-CQSZACIVSA-N |
| XLogP | 3.12 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.37 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |